返回题库

AIME 2009 II · 第 15 题

AIME 2009 II — Problem 15

专题
Contest Math
难度
L4
来源
AIME

题目详情

Problem

Let MN\overline{MN} be a diameter of a circle with diameter 1. Let AA and BB be points on one of the semicircular arcs determined by MN\overline{MN} such that AA is the midpoint of the semicircle and MB=35MB=\frac{3}5. Point CC lies on the other semicircular arc. Let dd be the length of the line segment whose endpoints are the intersections of diameter MN\overline{MN} with chords AC\overline{AC} and BC\overline{BC}. The largest possible value of dd can be written in the form rstr-s\sqrt{t}, where r,sr, s and tt are positive integers and tt is not divisible by the square of any prime. Find r+s+tr+s+t.

解析

Solutions

Solution 1 (Quick Calculus)

Let V=NMACV = \overline{NM} \cap \overline{AC} and W=NMBCW = \overline{NM} \cap \overline{BC}. Further more let NMC=α\angle NMC = \alpha and MNC=90α\angle MNC = 90^\circ - \alpha. Angle chasing reveals NBC=NAC=α\angle NBC = \angle NAC = \alpha and MBC=MAC=90α\angle MBC = \angle MAC = 90^\circ - \alpha. Additionally NB=45NB = \frac{4}{5} and AN=AMAN = AM by the Pythagorean Theorem.

By the Angle Bisector Formula,

NVMV=sin(α)sin(90α)=tan(α)\frac{NV}{MV} = \frac{\sin (\alpha)}{\sin (90^\circ - \alpha)} = \tan (\alpha) MWNW=3sin(90α)4sin(α)=34cot(α)\frac{MW}{NW} = \frac{3\sin (90^\circ - \alpha)}{4\sin (\alpha)} = \frac{3}{4} \cot (\alpha) As NV+MV=MW+NW=1NV + MV =MW + NW = 1 we compute NW=11+34cot(α)NW = \frac{1}{1+\frac{3}{4}\cot(\alpha)} and MV=11+tan(α)MV = \frac{1}{1+\tan (\alpha)}, and finally VW=NW+MV1=11+34cot(α)+11+tan(α)1VW = NW + MV - 1 = \frac{1}{1+\frac{3}{4}\cot(\alpha)} + \frac{1}{1+\tan (\alpha)} - 1. Taking the derivative of VWVW with respect to α\alpha, we arrive at

VW=7cos2(α)4(sin(α)+cos(α))2(4sin(α)+3cos(α))2VW' = \frac{7\cos^2 (\alpha) - 4}{(\sin(\alpha) + \cos(\alpha))^2(4\sin(\alpha)+3\cos(\alpha))^2} Clearly the maximum occurs when α=cos1(27)\alpha = \cos^{-1}\left(\frac{2}{\sqrt{7}}\right). Plugging this back in, using the fact that tan(cos1(x))=1x2x\tan(\cos^{-1}(x)) = \frac{\sqrt{1-x^2}}{x} and cot(cos1(x))=x1x2\cot(\cos^{-1}(x)) = \frac{x}{\sqrt{1-x^2}}, we get

VW=743VW = 7 - 4\sqrt{3} with 7+4+3=0147 + 4 + 3 = \boxed{014}

~always_correct

Solution 2 (Projective)

Since MA=220.707>35MA = \frac{\sqrt{2}}{2} \approx 0.707 > \frac{3}{5}, point BB lies between MM and AA on the semicircular arc. We will first compute the length of AB\overline{AB}. By the law of cosines, cosMOB=(3/5)2+2(1/2)22(1/2)2=725\cos \angle MOB = \frac{-(3/5)^2 + 2(1/2)^2}{2(1/2)^2} = \frac{7}{25}, so cosAOB=sinMOB=2425\cos \angle AOB = \sin \angle MOB = \frac{24}{25}. Then AB2=2(12)22(12)22425=150AB^2 = 2\left(\frac{1}{2}\right)^2 - 2\left(\frac{1}{2}\right)^2 \cdot \frac{24}{25} = \frac{1}{50}, so AB=152AB = \frac{1}{5\sqrt{2}}.

Let P=ACMNP = AC \cap MN and Q=BCMNQ = BC \cap MN, and let MQ=xMQ = x, PQ=dPQ = d, PN=yPN = y. Note that

(M,P;Q,N)=C(M,A;B,N),(M, P; Q, N) \stackrel{C}{=} (M, A; B, N), that is,

QPQM÷NPNM=BABM÷NANM\frac{QP}{QM} \div \frac{NP}{NM} = \frac{BA}{BM} \div \frac{NA}{NM} or

dxy=1/(52)(3/5)(2/2)=13.\frac{d}{xy} = \frac{1/(5\sqrt{2})}{(3/5) \cdot (\sqrt{2}/2)} = \frac{1}{3}. Hence d=13xyd = \frac{1}{3}xy, and we also know d+x+y=1d+x+y=1. Now AM-GM gives

x+y2xy    1d23d.\frac{x+y}{2} \ge \sqrt{xy} \implies \frac{1-d}{2} \ge \sqrt{3d}. This gives the quadratic inequality d214d+10d^2 - 14d + 1 \ge 0, which solves as

d(,743][7+43,).d \in \left(-\infty, 7-4\sqrt3\right] \cup \left[7+4\sqrt3, \infty\right). But d1d \le 1, so the greatest possible value of dd is 7437-4\sqrt3. The answer is 7+4+3=0147+4+3=\boxed{014}.

~MSTang

Solution 3 (Calculus)

Let OO be the center of the circle. Define MOC=t\angle{MOC}=t, BOA=2a\angle{BOA}=2a, and let BCBC and ACAC intersect MNMN at points XX and YY, respectively. We will express the length of XYXY as a function of tt and maximize that function in the interval [0,π][0, \pi].

Let CC' be the foot of the perpendicular from CC to MNMN. We compute XYXY as follows.

(a) By the Extended Law of Sines in triangle ABCABC, we have

CACA =sinABC= \sin\angle{ABC} =sin(AN^+NC^2)= \sin\left(\frac{\widehat{AN} + \widehat{NC}}{2}\right) =sin(π2+(πt)2)= \sin\left(\frac{\frac{\pi}{2} + (\pi-t)}{2}\right) =sin(3π4t2)= \sin\left(\frac{3\pi}{4} - \frac{t}{2}\right) =sin(π4+t2)= \sin\left(\frac{\pi}{4} + \frac{t}{2}\right) (b) Note that CC=COsin(t)=(12)sin(t)CC' = CO\sin(t) = \left(\frac{1}{2}\right)\sin(t) and AO=12AO = \frac{1}{2}. Since CCYCC'Y and AOYAOY are similar right triangles, we have CY/AY=CC/AO=sin(t)CY/AY = CC'/AO = \sin(t), and hence,

CY/CACY/CA =CYCY+AY= \frac{CY}{CY + AY} =sin(t)1+sin(t)= \frac{\sin(t)}{1 + \sin(t)} =sin(t)sin(π2)+sin(t)= \frac{\sin(t)}{\sin\left(\frac{\pi}{2}\right) + \sin(t)} =sin(t)2sin(π4+t2)cos(π4t2)= \frac{\sin(t)}{2\sin\left(\frac{\pi}{4} + \frac{t}{2}\right)\cos\left(\frac{\pi}{4} - \frac{t}{2}\right)} (c) We have XCY=AB^2=a\angle{XCY} = \frac{\widehat{AB}}{2}=a and CXY=MB^+CN^2=(π22a)+(πt)2=3π4at2\angle{CXY} = \frac{\widehat{MB}+\widehat{CN}}{2} = \frac{\left(\frac{\pi}{2} - 2a\right) + (\pi - t)}{2} = \frac{3\pi}{4} - a - \frac{t}{2}, and hence by the Law of Sines,

XY/CYXY/CY =sinXCYsinCXY= \frac{\sin\angle{XCY}}{\sin\angle{CXY}} =sin(a)sin(3π4at2)= \frac{\sin(a)}{\sin\left(\frac{3\pi}{4} - a - \frac{t}{2}\right)} =sin(a)sin(π4+a+t2)= \frac{\sin(a)}{\sin\left(\frac{\pi}{4} + a + \frac{t}{2}\right)} (d) Multiplying (a), (b), and (c), we have

XYXY =CA(CY/CA)(XY/CY)= CA * (CY/CA) * (XY/CY) =sin(t)sin(a)2cos(π4t2)sin(π4+a+t2)= \frac{\sin(t)\sin(a)}{2\cos\left(\frac{\pi}{4} - \frac{t}{2}\right)\sin\left(\frac{\pi}{4} + a + \frac{t}{2}\right)} =sin(t)sin(a)sin(π2+a)+sin(a+t)= \frac{\sin(t)\sin(a)}{\sin\left(\frac{\pi}{2} + a\right) + \sin(a + t)} =sin(a)×sin(t)sin(t+a)+cos(a)= \sin(a)\times\frac{\sin(t)}{\sin(t + a) + \cos(a)} ,

which is a function of tt (and the constant aa). Differentiating this with respect to tt yields

sin(a)×cos(t)(sin(t+a)+cos(a))sin(t)cos(t+a)(sin(t+a)+cos(a))2\sin(a)\times\frac{\cos(t)(\sin(t + a) + \cos(a)) - \sin(t)\cos(t + a)}{(\sin(t + a) + \cos(a))^2} ,

and the numerator of this is

sin(a)×(sin(t+a)cos(t)cos(t+a)sin(t)+cos(a)cos(t))\sin(a) \times(\sin(t + a)\cos(t) - \cos(t + a)\sin(t) + \cos(a)\cos(t)) =sin(a)×(sin(a)+cos(a)cos(t))= \sin(a) \times (\sin(a) + \cos(a)\cos(t)) ,

which vanishes when sin(a)+cos(a)cos(t)=0\sin(a) + \cos(a)\cos(t) = 0. Therefore, the length of XYXY is maximized when t=tt=t', where tt' is the value in [0,π][0, \pi] that satisfies cos(t)=tan(a)\cos(t') = -\tan(a).

Note that

1tan(a)1+tan(a)=tan(π4a)=tan((MB^)/2)=tanMNB=34\frac{1 - \tan(a)}{1 + \tan(a)} = \tan\left(\frac{\pi}{4} - a\right) = \tan((\widehat{MB})/2) = \tan\angle{MNB} = \frac{3}{4} ,

so tan(a)=17\tan(a) = \frac{1}{7}. We compute

sin(a)=210\sin(a) = \frac{\sqrt{2}}{10} cos(a)=7210\cos(a) = \frac{7\sqrt{2}}{10} cos(t)=tan(a)=17\cos(t') = -\tan(a) = -\frac{1}{7} sin(t)=437\sin(t') = \frac{4\sqrt{3}}{7} sin(t+a)=sin(t)cos(a)+cos(t)sin(a)=286270\sin(t' + a)=\sin(t')\cos(a) + \cos(t')\sin(a) = \frac{28\sqrt{6} - \sqrt{2}}{70} ,

so the maximum length of XYXY is sin(a)×sin(t)sin(t+a)+cos(a)=743\sin(a)\times\frac{\sin(t')}{\sin(t' + a) + \cos(a)} = 7 - 4\sqrt{3}, and the answer is 7+4+3=0147 + 4 + 3 = \boxed{014}.

Solution 4

AIME diagram

Suppose AC\overline{AC} and BC\overline{BC} intersect MN\overline{MN} at DD and EE, respectively, and let MC=xMC = x and NC=yNC = y. Since AA is the midpoint of arc MNMN, CA\overline{CA} bisects MCN\angle MCN, and we get

MCMD=NCNDMD=xx+y.\frac{MC}{MD} = \frac{NC}{ND}\Rightarrow MD = \frac{x}{x + y}. To find MEME, we note that BNEMCE\triangle BNE\sim\triangle MCE and BMENCE\triangle BME\sim\triangle NCE, so

BNNE=MCCEMEBM=CENC.\begin{aligned} \frac{BN}{NE} &= \frac{MC}{CE} \\ \frac{ME}{BM} &= \frac{CE}{NC}. \end{aligned} Writing NE=1MENE = 1 - ME, we can substitute known values and multiply the equations to get

4(ME)33(ME)=xyME=3x3x+4y.\frac{4(ME)}{3 - 3(ME)} = \frac{x}{y}\Rightarrow ME = \frac{3x}{3x + 4y}. The value we wish to maximize is

DE=MDME=xx+y3x3x+4y=xy3x2+7xy+4y2=13(x/y)+4(y/x)+7.\begin{aligned} DE &= MD - ME \\ &= \frac{x}{x + y} - \frac{3x}{3x + 4y} \\ &= \frac{xy}{3x^2 + 7xy + 4y^2} \\ &= \frac{1}{3(x/y) + 4(y/x) + 7}. \end{aligned} By the AM-GM inequality, 3(x/y)+4(y/x)212=433(x/y) + 4(y/x)\geq 2\sqrt{12} = 4\sqrt{3}, so

DE143+7=743,DE\leq \frac{1}{4\sqrt{3} + 7} = 7 - 4\sqrt{3}, giving the answer of 7+4+3=0147 + 4 + 3 = \boxed{014}. Equality is achieved when 3(x/y)=4(y/x)3(x/y) = 4(y/x) subject to the condition x2+y2=1x^2 + y^2 = 1, which occurs for x=277x = \frac{2\sqrt{7}}{7} and y=217y = \frac{\sqrt{21}}{7}.

Solution 5 (Projective)

By Pythagoras in BMN,\triangle BMN, we get BN=45.BN=\dfrac{4}{5}.

Since cross ratios are preserved upon projecting, note that (M,Y;X,N)=C(M,B;A,N).(M,Y;X,N)\stackrel{C}{=}(M,B;A,N). By definition of a cross ratio, this becomes

XMNY:NMNY=AMAB:MNNB.\dfrac{XM}{NY}:\dfrac{NM}{NY}=\dfrac{AM}{AB}:\dfrac{MN}{NB}. Let MY=a,YX=b,XN=cMY=a,YX=b,XN=c such that a+b+c=1.a+b+c=1. We know that XM=a+b,XY=b,NM=1,NY=b+c,XM=a+b,XY=b,NM=1,NY=b+c, so the LHS becomes (a+b)(b+c)b.\dfrac{(a+b)(b+c)}{b}.

In the RHS, we are given every value except for AB.AB. However, Ptolemy's Theorem on MBANMBAN gives ABMN+ANBM=AMBN    AB+352=452    AB=152.AB\cdot MN+AN\cdot BM=AM\cdot BN\implies AB+\dfrac{3}{5\sqrt{2}}=\dfrac{4}{5\sqrt{2}}\implies AB=\dfrac{1}{5\sqrt{2}}. Substituting, we get (a+b)(b+c)b=4    b(a+b+c)+ac=4b,b=ac3\dfrac{(a+b)(b+c)}{b}=4\implies b(a+b+c)+ac=4b, b=\dfrac{ac}{3} where we use a+b+c=1.a+b+c=1.

Again using a+b+c=1,a+b+c=1, we have a+b+c=1    a+ac3+c=1    a=31cc+3.a+b+c=1\implies a+\dfrac{ac}{3}+c=1\implies a=3\dfrac{1-c}{c+3}. Then b=ac3=cc2c+3.b=\dfrac{ac}{3}=\dfrac{c-c^2}{c+3}. Since this is a function in c,c, we differentiate WRT cc to find its maximum. By quotient rule, it suffices to solve

(2c+1)(c+3)(cc2)=0    c2+6c3,c=3+23.(-2c+1)(c+3)-(c-c^2)=0 \implies c^2+6c-3,c=-3+2\sqrt{3}. Substituting back yields b=743,b=7-4\sqrt{3}, so 7+4+3=0147+4+3=\boxed{014} is the answer.

~Generic_Username

Video Solution

https://youtu.be/4OZyKVD05Zg?si=yg1ndnP_GperfUx6

~MathProblemSolvingSkills.com